4 ms·
Why use the shorter chemical names when you can use the IUPAC name: N-(4-hydroxyphenyl)acetamide. If you’re talking about a chemical rather than a product, the
by jleyank 1y ago
Why use the shorter chemical names when you can use the IUPAC name: N-(4-hydroxyphenyl)acetamide. If you’re talking about a chemical rather than a product, there’s established nomenclature rules. Or, if you’re a computer type, use the SMILES notation CC(=O)Nc1ccc(O)cc1.
- gilleain 1y agoVery true. I refer to it by the InChI : InChI=1S/C8H9NO2/c1-6(10)9-7-2-4-8(11)5-3-7/h2-5,11H,1H3,(H,9,10) Or the key Key:RZVAJINKPMORJF-UHFFFAOYSA-N